C20H28N2O3 — CID 135230550
[1-(cyclohexylmethyl)-5-phenylmethoxypyrazol-3-yl]-ethoxymethanol (PubChem CID 135230550) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is [1-(cyclohexylmethyl)-5-phenylmethoxypyrazol-3-yl]-ethoxymethanol.
| Compound Name | [1-(cyclohexylmethyl)-5-phenylmethoxypyrazol-3-yl]-ethoxymethanol |
|---|---|
| PubChem CID | 135230550 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | [1-(cyclohexylmethyl)-5-phenylmethoxypyrazol-3-yl]-ethoxymethanol |
| SMILES | CCOC(O)c1cc(OCc2ccccc2)n(CC2CCCCC2)n1 |
| InChI | InChI=1S/C20H28N2O3/c1-2-24-20(23)18-13-19(25-15-17-11-7-4-8-12-17)22(21-18)14-16-9-5-3-6-10-16/h4,7-8,11-13,16,20,23H,2-3,5-6,9-10,14-15H2,1H3 |
| InChIKey | LXBGAGMJXNYMKD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|