C19H25N3O2 — CID 151018640
1-(cyclohexylmethyl)-5-phenylmethoxy-N-(trideuteriomethyl)pyrazole-3-carboxamide (PubChem CID 151018640) has the molecular formula C19H25N3O2 and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-5-phenylmethoxy-N-(trideuteriomethyl)pyrazole-3-carboxamide.
| Compound Name | 1-(cyclohexylmethyl)-5-phenylmethoxy-N-(trideuteriomethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 151018640 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-(cyclohexylmethyl)-5-phenylmethoxy-N-(trideuteriomethyl)pyrazole-3-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)c1cc(OCc2ccccc2)n(CC2CCCCC2)n1 |
| InChI | InChI=1S/C19H25N3O2/c1-20-19(23)17-12-18(24-14-16-10-6-3-7-11-16)22(21-17)13-15-8-4-2-5-9-15/h3,6-7,10-12,15H,2,4-5,8-9,13-14H2,1H3,(H,20,23)/i1D3 |
| InChIKey | LXPQJGWWOYWNAG-FIBGUPNXSA-N |
| XLogP | 3.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |