C35H48N4O4 — CID 122414317
N-[1-(butylamino)-4-methyl-1-oxopentan-3-yl]-1-(cyclohexylmethyl)-5-(2-methoxy-6-phenylmethoxyphenyl)pyrazole-3-carboxamide (PubChem CID 122414317) has the molecular formula C35H48N4O4 and a molecular weight of 588.79 g/mol. Its IUPAC name is N-[1-(butylamino)-4-methyl-1-oxopentan-3-yl]-1-(cyclohexylmethyl)-5-(2-methoxy-6-phenylmethoxyphenyl)pyrazole-3-carboxamide.
| Compound Name | N-[1-(butylamino)-4-methyl-1-oxopentan-3-yl]-1-(cyclohexylmethyl)-5-(2-methoxy-6-phenylmethoxyphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 122414317 |
| Molecular Formula | C35H48N4O4 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | N-[1-(butylamino)-4-methyl-1-oxopentan-3-yl]-1-(cyclohexylmethyl)-5-(2-methoxy-6-phenylmethoxyphenyl)pyrazole-3-carboxamide |
| SMILES | CCCCNC(=O)CC(NC(=O)c1cc(-c2c(OC)cccc2OCc2ccccc2)n(CC2CCCCC2)n1)C(C)C |
| InChI | InChI=1S/C35H48N4O4/c1-5-6-20-36-33(40)22-28(25(2)3)37-35(41)29-21-30(39(38-29)23-26-14-9-7-10-15-26)34-31(42-4)18-13-19-32(34)43-24-27-16-11-8-12-17-27/h8,11-13,16-19,21,25-26,28H,5-7,9-10,14-15,20,22-24H2,1-4H3,(H,36,40)(H,37,41) |
| InChIKey | ZKJWQIVMBHGVLQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|