C18H23NO5S — CID 121440121
(6-methyl-2-phenylmethoxy-4-propan-2-yloxy-3-pyridinyl)methyl methanesulfonate (PubChem CID 121440121) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is (6-methyl-2-phenylmethoxy-4-propan-2-yloxy-3-pyridinyl)methyl methanesulfonate.
| Compound Name | (6-methyl-2-phenylmethoxy-4-propan-2-yloxy-3-pyridinyl)methyl methanesulfonate |
|---|---|
| PubChem CID | 121440121 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (6-methyl-2-phenylmethoxy-4-propan-2-yloxy-3-pyridinyl)methyl methanesulfonate |
| SMILES | Cc1cc(OC(C)C)c(COS(C)(=O)=O)c(OCc2ccccc2)n1 |
| InChI | InChI=1S/C18H23NO5S/c1-13(2)24-17-10-14(3)19-18(16(17)12-23-25(4,20)21)22-11-15-8-6-5-7-9-15/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | XUOBSXMUNJORIY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|