C19H25NO4S — CID 126599269
(4-butan-2-yloxy-6-methyl-2-phenylmethoxy-3-pyridinyl)methyl methanesulfinate (PubChem CID 126599269) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is (4-butan-2-yloxy-6-methyl-2-phenylmethoxy-3-pyridinyl)methyl methanesulfinate.
| Compound Name | (4-butan-2-yloxy-6-methyl-2-phenylmethoxy-3-pyridinyl)methyl methanesulfinate |
|---|---|
| PubChem CID | 126599269 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (4-butan-2-yloxy-6-methyl-2-phenylmethoxy-3-pyridinyl)methyl methanesulfinate |
| SMILES | CCC(C)Oc1cc(C)nc(OCc2ccccc2)c1COS(C)=O |
| InChI | InChI=1S/C19H25NO4S/c1-5-15(3)24-18-11-14(2)20-19(17(18)13-23-25(4)21)22-12-16-9-7-6-8-10-16/h6-11,15H,5,12-13H2,1-4H3 |
| InChIKey | PELDMSRTZRBXAO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |