C17H18Br2O — CID 164892875
1,3-dibromo-5-(2-methylpropyl)-2-phenylmethoxybenzene (PubChem CID 164892875) has the molecular formula C17H18Br2O and a molecular weight of 398.14 g/mol. Its IUPAC name is 1,3-dibromo-5-(2-methylpropyl)-2-phenylmethoxybenzene.
| Compound Name | 1,3-dibromo-5-(2-methylpropyl)-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 164892875 |
| Molecular Formula | C17H18Br2O |
| Molecular Weight | 398.14 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 1,3-dibromo-5-(2-methylpropyl)-2-phenylmethoxybenzene |
| SMILES | CC(C)Cc1cc(Br)c(OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C17H18Br2O/c1-12(2)8-14-9-15(18)17(16(19)10-14)20-11-13-6-4-3-5-7-13/h3-7,9-10,12H,8,11H2,1-2H3 |
| InChIKey | YALDQODDAHNKNL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.14 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |