C21H18N2O5S — CID 135328825
(4-methyl-6-phenylmethoxy-[1,3]oxazolo[4,5-c]pyridin-7-yl)methyl benzenesulfonate (PubChem CID 135328825) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is (4-methyl-6-phenylmethoxy-[1,3]oxazolo[4,5-c]pyridin-7-yl)methyl benzenesulfonate.
| Compound Name | (4-methyl-6-phenylmethoxy-[1,3]oxazolo[4,5-c]pyridin-7-yl)methyl benzenesulfonate |
|---|---|
| PubChem CID | 135328825 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (4-methyl-6-phenylmethoxy-[1,3]oxazolo[4,5-c]pyridin-7-yl)methyl benzenesulfonate |
| SMILES | Cc1nc(OCc2ccccc2)c(COS(=O)(=O)c2ccccc2)c2ocnc12 |
| InChI | InChI=1S/C21H18N2O5S/c1-15-19-20(27-14-22-19)18(13-28-29(24,25)17-10-6-3-7-11-17)21(23-15)26-12-16-8-4-2-5-9-16/h2-11,14H,12-13H2,1H3 |
| InChIKey | GBSDZVKYYSNSEI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|