C25H22N2O5S — CID 174898792
[2,4-bis(phenylmethoxy)pyrimidin-5-yl] 4-methylbenzenesulfonate (PubChem CID 174898792) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is [2,4-bis(phenylmethoxy)pyrimidin-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [2,4-bis(phenylmethoxy)pyrimidin-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 174898792 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | [2,4-bis(phenylmethoxy)pyrimidin-5-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cnc(OCc3ccccc3)nc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O5S/c1-19-12-14-22(15-13-19)33(28,29)32-23-16-26-25(31-18-21-10-6-3-7-11-21)27-24(23)30-17-20-8-4-2-5-9-20/h2-16H,17-18H2,1H3 |
| InChIKey | PCUDIKBNSINXPE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|