C28H24N2O4S — CID 102079654
[4-[benzimidazol-1-yl(phenylmethoxy)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 102079654) has the molecular formula C28H24N2O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is [4-[benzimidazol-1-yl(phenylmethoxy)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[benzimidazol-1-yl(phenylmethoxy)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102079654 |
| Molecular Formula | C28H24N2O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [4-[benzimidazol-1-yl(phenylmethoxy)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(OCc3ccccc3)n3cnc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C28H24N2O4S/c1-21-11-17-25(18-12-21)35(31,32)34-24-15-13-23(14-16-24)28(33-19-22-7-3-2-4-8-22)30-20-29-26-9-5-6-10-27(26)30/h2-18,20,28H,19H2,1H3 |
| InChIKey | CVGAKUYHQABCKN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|