C19H16F2N2O3 — CID 167327400
5-(difluoromethoxy)-2,4-bis(phenylmethoxy)pyrimidine (PubChem CID 167327400) has the molecular formula C19H16F2N2O3 and a molecular weight of 358.34 g/mol. Its IUPAC name is 5-(difluoromethoxy)-2,4-bis(phenylmethoxy)pyrimidine.
| Compound Name | 5-(difluoromethoxy)-2,4-bis(phenylmethoxy)pyrimidine |
|---|---|
| PubChem CID | 167327400 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 5-(difluoromethoxy)-2,4-bis(phenylmethoxy)pyrimidine |
| SMILES | FC(F)Oc1cnc(OCc2ccccc2)nc1OCc1ccccc1 |
| InChI | InChI=1S/C19H16F2N2O3/c20-18(21)26-16-11-22-19(25-13-15-9-5-2-6-10-15)23-17(16)24-12-14-7-3-1-4-8-14/h1-11,18H,12-13H2 |
| InChIKey | ANZLYNILUHVYDU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |