C20H19ClN2O2 — CID 59686866
4-chloro-5-ethyl-2,6-bis(phenylmethoxy)pyrimidine (PubChem CID 59686866) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 4-chloro-5-ethyl-2,6-bis(phenylmethoxy)pyrimidine.
| Compound Name | 4-chloro-5-ethyl-2,6-bis(phenylmethoxy)pyrimidine |
|---|---|
| PubChem CID | 59686866 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 4-chloro-5-ethyl-2,6-bis(phenylmethoxy)pyrimidine |
| SMILES | CCc1c(Cl)nc(OCc2ccccc2)nc1OCc1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-2-17-18(21)22-20(25-14-16-11-7-4-8-12-16)23-19(17)24-13-15-9-5-3-6-10-15/h3-12H,2,13-14H2,1H3 |
| InChIKey | QFJSNGCJUSOWSD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |