C22H20ClNO4 — CID 159161134
6-chloro-5-ethyl-2,4-bis(phenylmethoxy)pyridine-3-carboxylic acid (PubChem CID 159161134) has the molecular formula C22H20ClNO4 and a molecular weight of 397.86 g/mol. Its IUPAC name is 6-chloro-5-ethyl-2,4-bis(phenylmethoxy)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-5-ethyl-2,4-bis(phenylmethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159161134 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 6-chloro-5-ethyl-2,4-bis(phenylmethoxy)pyridine-3-carboxylic acid |
| SMILES | CCc1c(Cl)nc(OCc2ccccc2)c(C(=O)O)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H20ClNO4/c1-2-17-19(27-13-15-9-5-3-6-10-15)18(22(25)26)21(24-20(17)23)28-14-16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3,(H,25,26) |
| InChIKey | KKMNZIDQFZATKP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|