C18H18ClNO4 — CID 169250770
ethyl 2-chloro-6-methyl-5-(2-oxoethyl)-4-phenylmethoxypyridine-3-carboxylate (PubChem CID 169250770) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is ethyl 2-chloro-6-methyl-5-(2-oxoethyl)-4-phenylmethoxypyridine-3-carboxylate.
| Compound Name | ethyl 2-chloro-6-methyl-5-(2-oxoethyl)-4-phenylmethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 169250770 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | ethyl 2-chloro-6-methyl-5-(2-oxoethyl)-4-phenylmethoxypyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)nc(C)c(CC=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C18H18ClNO4/c1-3-23-18(22)15-16(24-11-13-7-5-4-6-8-13)14(9-10-21)12(2)20-17(15)19/h4-8,10H,3,9,11H2,1-2H3 |
| InChIKey | GHPISUGMEDDQAQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|