C16H13ClIN3O3 — CID 58208939
ethyl 6-chloro-5-iodo-7-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate (PubChem CID 58208939) has the molecular formula C16H13ClIN3O3 and a molecular weight of 457.66 g/mol. Its IUPAC name is ethyl 6-chloro-5-iodo-7-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate.
| Compound Name | ethyl 6-chloro-5-iodo-7-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 58208939 |
| Molecular Formula | C16H13ClIN3O3 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 456.97 |
| IUPAC Name | ethyl 6-chloro-5-iodo-7-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
| SMILES | CCOC(=O)c1c(OCc2ccccc2)c(Cl)c(I)n2ncnc12 |
| InChI | InChI=1S/C16H13ClIN3O3/c1-2-23-16(22)11-13(24-8-10-6-4-3-5-7-10)12(17)14(18)21-15(11)19-9-20-21/h3-7,9H,2,8H2,1H3 |
| InChIKey | YFTRZRIWNVVDFC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|