C19H24ClNO3 — CID 169250389
ethane;ethyl 2-chloro-5,6-dimethyl-4-phenylmethoxypyridine-3-carboxylate (PubChem CID 169250389) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is ethane;ethyl 2-chloro-5,6-dimethyl-4-phenylmethoxypyridine-3-carboxylate.
| Compound Name | ethane;ethyl 2-chloro-5,6-dimethyl-4-phenylmethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 169250389 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | ethane;ethyl 2-chloro-5,6-dimethyl-4-phenylmethoxypyridine-3-carboxylate |
| SMILES | CC.CCOC(=O)c1c(Cl)nc(C)c(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C17H18ClNO3.C2H6/c1-4-21-17(20)14-15(11(2)12(3)19-16(14)18)22-10-13-8-6-5-7-9-13;1-2/h5-9H,4,10H2,1-3H3;1-2H3 |
| InChIKey | UFJYNVCJMZNOMZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|