C18H18ClNO5 — CID 169250757
2-(6-chloro-5-ethoxycarbonyl-2-methyl-4-phenylmethoxy-3-pyridinyl)acetic acid (PubChem CID 169250757) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is 2-(6-chloro-5-ethoxycarbonyl-2-methyl-4-phenylmethoxy-3-pyridinyl)acetic acid.
| Compound Name | 2-(6-chloro-5-ethoxycarbonyl-2-methyl-4-phenylmethoxy-3-pyridinyl)acetic acid |
|---|---|
| PubChem CID | 169250757 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-(6-chloro-5-ethoxycarbonyl-2-methyl-4-phenylmethoxy-3-pyridinyl)acetic acid |
| SMILES | CCOC(=O)c1c(Cl)nc(C)c(CC(=O)O)c1OCc1ccccc1 |
| InChI | InChI=1S/C18H18ClNO5/c1-3-24-18(23)15-16(25-10-12-7-5-4-6-8-12)13(9-14(21)22)11(2)20-17(15)19/h4-8H,3,9-10H2,1-2H3,(H,21,22) |
| InChIKey | UIPCSCYCVQVFHM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|