C27H22F4N2O4 — CID 21262814
5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-2-phenylmethoxypyridine (PubChem CID 21262814) has the molecular formula C27H22F4N2O4 and a molecular weight of 514.48 g/mol. Its IUPAC name is 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-2-phenylmethoxypyridine.
| Compound Name | 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-2-phenylmethoxypyridine |
|---|---|
| PubChem CID | 21262814 |
| Molecular Formula | C27H22F4N2O4 |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-2-phenylmethoxypyridine |
| SMILES | [O-][n+]1ccc(CC(c2ccc(OCc3ccccc3)nc2)c2ccc(OC(F)F)c(OC(F)F)c2)cc1 |
| InChI | InChI=1S/C27H22F4N2O4/c28-26(29)36-23-8-6-20(15-24(23)37-27(30)31)22(14-18-10-12-33(34)13-11-18)21-7-9-25(32-16-21)35-17-19-4-2-1-3-5-19/h1-13,15-16,22,26-27H,14,17H2 |
| InChIKey | LAKWOLDKTFYXIX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|