C33H42N2O5 — CID 91183598
2-[4-[[5-[1-(3,4-dimethoxyphenyl)-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-2-pyridinyl]oxy]phenyl]propan-2-ol;ethane (PubChem CID 91183598) has the molecular formula C33H42N2O5 and a molecular weight of 546.71 g/mol. Its IUPAC name is 2-[4-[[5-[1-(3,4-dimethoxyphenyl)-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-2-pyridinyl]oxy]phenyl]propan-2-ol;ethane.
| Compound Name | 2-[4-[[5-[1-(3,4-dimethoxyphenyl)-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-2-pyridinyl]oxy]phenyl]propan-2-ol;ethane |
|---|---|
| PubChem CID | 91183598 |
| Molecular Formula | C33H42N2O5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | 2-[4-[[5-[1-(3,4-dimethoxyphenyl)-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-2-pyridinyl]oxy]phenyl]propan-2-ol;ethane |
| SMILES | CC.CC.COc1ccc(C(Cc2cc[n+]([O-])cc2)c2ccc(Oc3ccc(C(C)(C)O)cc3)nc2)cc1OC |
| InChI | InChI=1S/C29H30N2O5.2C2H6/c1-29(2,32)23-7-9-24(10-8-23)36-28-12-6-22(19-30-28)25(17-20-13-15-31(33)16-14-20)21-5-11-26(34-3)27(18-21)35-4;2*1-2/h5-16,18-19,25,32H,17H2,1-4H3;2*1-2H3 |
| InChIKey | ZOBPXPIWIDEVSW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|