C26H22F4N2O4S — CID 10208858
1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-phenylethanol (PubChem CID 10208858) has the molecular formula C26H22F4N2O4S and a molecular weight of 534.53 g/mol. Its IUPAC name is 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-phenylethanol.
| Compound Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 10208858 |
| Molecular Formula | C26H22F4N2O4S |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-phenylethanol |
| SMILES | CC(O)(c1ccccc1)c1ncc(C(Cc2cc[n+]([O-])cc2)c2ccc(OC(F)F)c(OC(F)F)c2)s1 |
| InChI | InChI=1S/C26H22F4N2O4S/c1-26(33,18-5-3-2-4-6-18)23-31-15-22(37-23)19(13-16-9-11-32(34)12-10-16)17-7-8-20(35-24(27)28)21(14-17)36-25(29)30/h2-12,14-15,19,24-25,33H,13H2,1H3 |
| InChIKey | ZLPSOCTUSQPSDH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|