C22H20F4N2O4S — CID 10140865
1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]cyclobutan-1-ol (PubChem CID 10140865) has the molecular formula C22H20F4N2O4S and a molecular weight of 484.47 g/mol. Its IUPAC name is 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]cyclobutan-1-ol.
| Compound Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 10140865 |
| Molecular Formula | C22H20F4N2O4S |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
| SMILES | [O-][n+]1ccc(CC(c2ccc(OC(F)F)c(OC(F)F)c2)c2cnc(C3(O)CCC3)s2)cc1 |
| InChI | InChI=1S/C22H20F4N2O4S/c23-20(24)31-16-3-2-14(11-17(16)32-21(25)26)15(10-13-4-8-28(30)9-5-13)18-12-27-19(33-18)22(29)6-1-7-22/h2-5,8-9,11-12,15,20-21,29H,1,6-7,10H2 |
| InChIKey | OESLILFNHIAJHP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|