C25H24F4N2O4 — CID 54354326
2-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-5-(3-propan-2-yloxiran-2-yl)pyridine (PubChem CID 54354326) has the molecular formula C25H24F4N2O4 and a molecular weight of 492.47 g/mol. Its IUPAC name is 2-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-5-(3-propan-2-yloxiran-2-yl)pyridine.
| Compound Name | 2-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-5-(3-propan-2-yloxiran-2-yl)pyridine |
|---|---|
| PubChem CID | 54354326 |
| Molecular Formula | C25H24F4N2O4 |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 2-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-5-(3-propan-2-yloxiran-2-yl)pyridine |
| SMILES | CC(C)C1OC1c1ccc(C(Cc2cc[n+]([O-])cc2)c2ccc(OC(F)F)c(OC(F)F)c2)nc1 |
| InChI | InChI=1S/C25H24F4N2O4/c1-14(2)22-23(35-22)17-3-5-19(30-13-17)18(11-15-7-9-31(32)10-8-15)16-4-6-20(33-24(26)27)21(12-16)34-25(28)29/h3-10,12-14,18,22-25H,11H2,1-2H3 |
| InChIKey | UIAQXCKUWGNQBK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 70.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|