C29H25F4N3O3 — CID 59945763
5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-N-(2,3-dihydro-1H-inden-2-yl)pyridin-2-amine (PubChem CID 59945763) has the molecular formula C29H25F4N3O3 and a molecular weight of 539.53 g/mol. Its IUPAC name is 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-N-(2,3-dihydro-1H-inden-2-yl)pyridin-2-amine.
| Compound Name | 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-N-(2,3-dihydro-1H-inden-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 59945763 |
| Molecular Formula | C29H25F4N3O3 |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-N-(2,3-dihydro-1H-inden-2-yl)pyridin-2-amine |
| SMILES | [O-][n+]1ccc(CC(c2ccc(NC3Cc4ccccc4C3)nc2)c2ccc(OC(F)F)c(OC(F)F)c2)cc1 |
| InChI | InChI=1S/C29H25F4N3O3/c30-28(31)38-25-7-5-21(16-26(25)39-29(32)33)24(13-18-9-11-36(37)12-10-18)22-6-8-27(34-17-22)35-23-14-19-3-1-2-4-20(19)15-23/h1-12,16-17,23-24,28-29H,13-15H2,(H,34,35) |
| InChIKey | QFZNCJHULLMSKI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|