C27H26F4N2O4 — CID 70079642
2-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-5-(7-oxabicyclo[4.2.0]octan-8-yl)pyridine (PubChem CID 70079642) has the molecular formula C27H26F4N2O4 and a molecular weight of 518.51 g/mol. Its IUPAC name is 2-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-5-(7-oxabicyclo[4.2.0]octan-8-yl)pyridine.
| Compound Name | 2-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-5-(7-oxabicyclo[4.2.0]octan-8-yl)pyridine |
|---|---|
| PubChem CID | 70079642 |
| Molecular Formula | C27H26F4N2O4 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-5-(7-oxabicyclo[4.2.0]octan-8-yl)pyridine |
| SMILES | [O-][n+]1ccc(CC(c2ccc(OC(F)F)c(OC(F)F)c2)c2ccc(C3OC4CCCCC43)cn2)cc1 |
| InChI | InChI=1S/C27H26F4N2O4/c28-26(29)36-23-8-6-17(14-24(23)37-27(30)31)20(13-16-9-11-33(34)12-10-16)21-7-5-18(15-32-21)25-19-3-1-2-4-22(19)35-25/h5-12,14-15,19-20,22,25-27H,1-4,13H2 |
| InChIKey | BFCXTESEBZXRHU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|