C23H18F8N2O3S — CID 59103210
2-[5-[1-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-2-pyridin-3-ylethyl]-1,3-thiazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 59103210) has the molecular formula C23H18F8N2O3S and a molecular weight of 554.46 g/mol. Its IUPAC name is 2-[5-[1-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-2-pyridin-3-ylethyl]-1,3-thiazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[5-[1-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-2-pyridin-3-ylethyl]-1,3-thiazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 59103210 |
| Molecular Formula | C23H18F8N2O3S |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | 2-[5-[1-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-2-pyridin-3-ylethyl]-1,3-thiazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ncc(C(Cc2cccnc2)c2ccc(OC(F)F)c(OC3CC3)c2)s1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H18F8N2O3S/c24-20(25)36-16-6-3-13(9-17(16)35-14-4-5-14)15(8-12-2-1-7-32-10-12)18-11-33-19(37-18)21(34,22(26,27)28)23(29,30)31/h1-3,6-7,9-11,14-15,20,34H,4-5,8H2 |
| InChIKey | FYOFUHITWFTSDG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |