C12H13NO4S — CID 170902191
(5-methyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate (PubChem CID 170902191) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is (5-methyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (5-methyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 170902191 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (5-methyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2ncoc2C)cc1 |
| InChI | InChI=1S/C12H13NO4S/c1-9-3-5-11(6-4-9)18(14,15)17-7-12-10(2)16-8-13-12/h3-6,8H,7H2,1-2H3 |
| InChIKey | GDGMUMJZGXSRQI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|