C12H14N4O3S — CID 54346153
(2,4-diaminopyrimidin-5-yl)methyl 4-methylbenzenesulfonate (PubChem CID 54346153) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is (2,4-diaminopyrimidin-5-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (2,4-diaminopyrimidin-5-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54346153 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2,4-diaminopyrimidin-5-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2cnc(N)nc2N)cc1 |
| InChI | InChI=1S/C12H14N4O3S/c1-8-2-4-10(5-3-8)20(17,18)19-7-9-6-15-12(14)16-11(9)13/h2-6H,7H2,1H3,(H4,13,14,15,16) |
| InChIKey | UCLBQQIMKSDCPQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|