C14H14OS — CID 87483111
5-methyl-2-phenylmethoxycyclohexa-2,4-diene-1-thione (PubChem CID 87483111) has the molecular formula C14H14OS and a molecular weight of 230.33 g/mol. Its IUPAC name is 5-methyl-2-phenylmethoxycyclohexa-2,4-diene-1-thione.
| Compound Name | 5-methyl-2-phenylmethoxycyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87483111 |
| Molecular Formula | C14H14OS |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-methyl-2-phenylmethoxycyclohexa-2,4-diene-1-thione |
| SMILES | CC1=CC=C(OCc2ccccc2)C(=S)C1 |
| InChI | InChI=1S/C14H14OS/c1-11-7-8-13(14(16)9-11)15-10-12-5-3-2-4-6-12/h2-8H,9-10H2,1H3 |
| InChIKey | FTGXYDKERBJHKQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|