C30H34N2O3 — CID 142198213
N-cyclopentyl-2-methyl-N-[2-methyl-1-(4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)prop-1-enyl]-4-nitroaniline (PubChem CID 142198213) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is N-cyclopentyl-2-methyl-N-[2-methyl-1-(4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)prop-1-enyl]-4-nitroaniline.
| Compound Name | N-cyclopentyl-2-methyl-N-[2-methyl-1-(4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)prop-1-enyl]-4-nitroaniline |
|---|---|
| PubChem CID | 142198213 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | N-cyclopentyl-2-methyl-N-[2-methyl-1-(4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)prop-1-enyl]-4-nitroaniline |
| SMILES | CC(C)=C(C1=CC=C(OCc2ccccc2)C=CC1)N(c1ccc([N+](=O)[O-])cc1C)C1CCCC1 |
| InChI | InChI=1S/C30H34N2O3/c1-22(2)30(25-12-9-15-28(18-16-25)35-21-24-10-5-4-6-11-24)31(26-13-7-8-14-26)29-19-17-27(32(33)34)20-23(29)3/h4-6,9-11,15-20,26H,7-8,12-14,21H2,1-3H3 |
| InChIKey | AEQTWNHWEIIHNQ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|