C20H22N2O6 — CID 175145304
1-methoxy-4-nitro-2-phenylmethoxybenzene;pyrrolidine-1,2-dicarbaldehyde (PubChem CID 175145304) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 1-methoxy-4-nitro-2-phenylmethoxybenzene;pyrrolidine-1,2-dicarbaldehyde.
| Compound Name | 1-methoxy-4-nitro-2-phenylmethoxybenzene;pyrrolidine-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 175145304 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-methoxy-4-nitro-2-phenylmethoxybenzene;pyrrolidine-1,2-dicarbaldehyde |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCc1ccccc1.O=CC1CCCN1C=O |
| InChI | InChI=1S/C14H13NO4.C6H9NO2/c1-18-13-8-7-12(15(16)17)9-14(13)19-10-11-5-3-2-4-6-11;8-4-6-2-1-3-7(6)5-9/h2-9H,10H2,1H3;4-6H,1-3H2 |
| InChIKey | HFIIGKYTDDLCDT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|