C24H25NO3 — CID 171774334
2-cyclobutyl-4-nitro-1-phenylmethoxybenzene;toluene (PubChem CID 171774334) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-cyclobutyl-4-nitro-1-phenylmethoxybenzene;toluene.
| Compound Name | 2-cyclobutyl-4-nitro-1-phenylmethoxybenzene;toluene |
|---|---|
| PubChem CID | 171774334 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-cyclobutyl-4-nitro-1-phenylmethoxybenzene;toluene |
| SMILES | Cc1ccccc1.O=[N+]([O-])c1ccc(OCc2ccccc2)c(C2CCC2)c1 |
| InChI | InChI=1S/C17H17NO3.C7H8/c19-18(20)15-9-10-17(16(11-15)14-7-4-8-14)21-12-13-5-2-1-3-6-13;1-7-5-3-2-4-6-7/h1-3,5-6,9-11,14H,4,7-8,12H2;2-6H,1H3 |
| InChIKey | DJUDUBGHJJMYLO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|