C21H25N3O9 — CID 87886391
2-methoxy-5-nitrophenol;4-[(2-methoxy-4-nitrophenoxy)methyl]piperidine-1-carbaldehyde (PubChem CID 87886391) has the molecular formula C21H25N3O9 and a molecular weight of 463.44 g/mol. Its IUPAC name is 2-methoxy-5-nitrophenol;4-[(2-methoxy-4-nitrophenoxy)methyl]piperidine-1-carbaldehyde.
| Compound Name | 2-methoxy-5-nitrophenol;4-[(2-methoxy-4-nitrophenoxy)methyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 87886391 |
| Molecular Formula | C21H25N3O9 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-methoxy-5-nitrophenol;4-[(2-methoxy-4-nitrophenoxy)methyl]piperidine-1-carbaldehyde |
| SMILES | COc1cc([N+](=O)[O-])ccc1OCC1CCN(C=O)CC1.COc1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C14H18N2O5.C7H7NO4/c1-20-14-8-12(16(18)19)2-3-13(14)21-9-11-4-6-15(10-17)7-5-11;1-12-7-3-2-5(8(10)11)4-6(7)9/h2-3,8,10-11H,4-7,9H2,1H3;2-4,9H,1H3 |
| InChIKey | OUPPUXBWKPIXTM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|