C20H25N3O8 — CID 87887958
2-methoxy-5-nitrophenol;2-methoxy-4-nitro-1-(phenoxymethyl)piperidine (PubChem CID 87887958) has the molecular formula C20H25N3O8 and a molecular weight of 435.43 g/mol. Its IUPAC name is 2-methoxy-5-nitrophenol;2-methoxy-4-nitro-1-(phenoxymethyl)piperidine.
| Compound Name | 2-methoxy-5-nitrophenol;2-methoxy-4-nitro-1-(phenoxymethyl)piperidine |
|---|---|
| PubChem CID | 87887958 |
| Molecular Formula | C20H25N3O8 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-methoxy-5-nitrophenol;2-methoxy-4-nitro-1-(phenoxymethyl)piperidine |
| SMILES | COC1CC([N+](=O)[O-])CCN1COc1ccccc1.COc1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C13H18N2O4.C7H7NO4/c1-18-13-9-11(15(16)17)7-8-14(13)10-19-12-5-3-2-4-6-12;1-12-7-3-2-5(8(10)11)4-6(7)9/h2-6,11,13H,7-10H2,1H3;2-4,9H,1H3 |
| InChIKey | VLUKWJZYIIVZES-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|