About ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine
ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine (PubChem CID 145108015) has the molecular formula C22H30N2O5
and a molecular weight of 402.49 g/mol. Its IUPAC name is ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine.
Molecular Properties
| Compound Name | ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine |
| PubChem CID | 145108015 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine |
| SMILES | CC.COc1cc([N+](=O)[O-])ccc1OC1(C)CCN(CCOc2ccccc2)C1 |
| InChI | InChI=1S/C20H24N2O5.C2H6/c1-20(27-18-9-8-16(22(23)24)14-19(18)25-2)10-11-21(15-20)12-13-26-17-6-4-3-5-7-17;1-2/h3-9,14H,10-13,15H2,1-2H3;1-2H3 |
| InChIKey | HMFUXYSDVABFJA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine?
The IUPAC name of ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine (CID 145108015) is ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine.
What is the SMILES notation for ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine?
The canonical SMILES for ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine is CC.COc1cc([N+](=O)[O-])ccc1OC1(C)CCN(CCOc2ccccc2)C1.
What is the InChIKey of ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine?
The InChIKey is HMFUXYSDVABFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O5.C2H6/c1-20(27-18-9-8-16(22(23)24)14-19(18)25-2)10-11-21(15-20)12-13-26-17-6-4-3-5-7-17;1-2/h3-9,14H,10-13,15H2,1-2H3;1-2H3.
What are the key properties of ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine?
ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine has a molecular weight of 402.49 g/mol, XLogP of 4.55, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(2-methoxy-4-nitrophenoxy)-3-methyl-1-(2-phenoxyethyl)pyrrolidine is sourced from PubChem (CID 145108015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).