C32H50N4O6 — CID 158012628
3-[2-(4,4-dimethylpiperidin-1-yl)ethoxy]-4-methoxyaniline;1-[2-(2-methoxy-5-nitrophenoxy)ethyl]-4,4-dimethylpiperidine (PubChem CID 158012628) has the molecular formula C32H50N4O6 and a molecular weight of 586.77 g/mol. Its IUPAC name is 3-[2-(4,4-dimethylpiperidin-1-yl)ethoxy]-4-methoxyaniline;1-[2-(2-methoxy-5-nitrophenoxy)ethyl]-4,4-dimethylpiperidine.
| Compound Name | 3-[2-(4,4-dimethylpiperidin-1-yl)ethoxy]-4-methoxyaniline;1-[2-(2-methoxy-5-nitrophenoxy)ethyl]-4,4-dimethylpiperidine |
|---|---|
| PubChem CID | 158012628 |
| Molecular Formula | C32H50N4O6 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | 3-[2-(4,4-dimethylpiperidin-1-yl)ethoxy]-4-methoxyaniline;1-[2-(2-methoxy-5-nitrophenoxy)ethyl]-4,4-dimethylpiperidine |
| SMILES | COc1ccc(N)cc1OCCN1CCC(C)(C)CC1.COc1ccc([N+](=O)[O-])cc1OCCN1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H24N2O4.C16H26N2O2/c1-16(2)6-8-17(9-7-16)10-11-22-15-12-13(18(19)20)4-5-14(15)21-3;1-16(2)6-8-18(9-7-16)10-11-20-15-12-13(17)4-5-14(15)19-3/h4-5,12H,6-11H2,1-3H3;4-5,12H,6-11,17H2,1-3H3 |
| InChIKey | FFBSCYBXWJRXGS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 112.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|