C22H27BrFN3O8 — CID 87801734
1-(2-bromoethoxy)-2-methoxy-4-nitrobenzene;3-fluoro-1-[2-(2-methoxy-4-nitrophenoxy)ethyl]pyrrolidine (PubChem CID 87801734) has the molecular formula C22H27BrFN3O8 and a molecular weight of 560.37 g/mol. Its IUPAC name is 1-(2-bromoethoxy)-2-methoxy-4-nitrobenzene;3-fluoro-1-[2-(2-methoxy-4-nitrophenoxy)ethyl]pyrrolidine.
| Compound Name | 1-(2-bromoethoxy)-2-methoxy-4-nitrobenzene;3-fluoro-1-[2-(2-methoxy-4-nitrophenoxy)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 87801734 |
| Molecular Formula | C22H27BrFN3O8 |
| Molecular Weight | 560.37 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 1-(2-bromoethoxy)-2-methoxy-4-nitrobenzene;3-fluoro-1-[2-(2-methoxy-4-nitrophenoxy)ethyl]pyrrolidine |
| SMILES | COc1cc([N+](=O)[O-])ccc1OCCBr.COc1cc([N+](=O)[O-])ccc1OCCN1CCC(F)C1 |
| InChI | InChI=1S/C13H17FN2O4.C9H10BrNO4/c1-19-13-8-11(16(17)18)2-3-12(13)20-7-6-15-5-4-10(14)9-15;1-14-9-6-7(11(12)13)2-3-8(9)15-5-4-10/h2-3,8,10H,4-7,9H2,1H3;2-3,6H,4-5H2,1H3 |
| InChIKey | KLNPREQGNSBAJX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|