C27H30N2O6 — CID 53390923
6,7-dimethoxy-2-[3-(4-nitrophenoxy)propyl]-1-(phenoxymethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 53390923) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[3-(4-nitrophenoxy)propyl]-1-(phenoxymethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-[3-(4-nitrophenoxy)propyl]-1-(phenoxymethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 53390923 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 6,7-dimethoxy-2-[3-(4-nitrophenoxy)propyl]-1-(phenoxymethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)C(COc1ccccc1)N(CCCOc1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C27H30N2O6/c1-32-26-17-20-13-15-28(14-6-16-34-23-11-9-21(10-12-23)29(30)31)25(24(20)18-27(26)33-2)19-35-22-7-4-3-5-8-22/h3-5,7-12,17-18,25H,6,13-16,19H2,1-2H3 |
| InChIKey | QJWCNPALCAFEFY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|