C31H33ClN2O5 — CID 53391098
6,7-dimethoxy-1-(naphthalen-1-ylmethyl)-2-[3-(4-nitrophenoxy)propyl]-3,4-dihydro-1H-isoquinoline;hydrochloride (PubChem CID 53391098) has the molecular formula C31H33ClN2O5 and a molecular weight of 549.07 g/mol. Its IUPAC name is 6,7-dimethoxy-1-(naphthalen-1-ylmethyl)-2-[3-(4-nitrophenoxy)propyl]-3,4-dihydro-1H-isoquinoline;hydrochloride.
| Compound Name | 6,7-dimethoxy-1-(naphthalen-1-ylmethyl)-2-[3-(4-nitrophenoxy)propyl]-3,4-dihydro-1H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 53391098 |
| Molecular Formula | C31H33ClN2O5 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 6,7-dimethoxy-1-(naphthalen-1-ylmethyl)-2-[3-(4-nitrophenoxy)propyl]-3,4-dihydro-1H-isoquinoline;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(Cc1cccc3ccccc13)N(CCCOc1ccc([N+](=O)[O-])cc1)CC2.Cl |
| InChI | InChI=1S/C31H32N2O5.ClH/c1-36-30-20-24-15-17-32(16-6-18-38-26-13-11-25(12-14-26)33(34)35)29(28(24)21-31(30)37-2)19-23-9-5-8-22-7-3-4-10-27(22)23;/h3-5,7-14,20-21,29H,6,15-19H2,1-2H3;1H |
| InChIKey | VIQPTJFWNWWXKP-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|