C27H31ClN2O6 — CID 53391190
6,7-dimethoxy-2-[3-(2-nitrophenoxy)propyl]-1-(phenoxymethyl)-3,4-dihydro-1H-isoquinoline;hydrochloride (PubChem CID 53391190) has the molecular formula C27H31ClN2O6 and a molecular weight of 515.01 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[3-(2-nitrophenoxy)propyl]-1-(phenoxymethyl)-3,4-dihydro-1H-isoquinoline;hydrochloride.
| Compound Name | 6,7-dimethoxy-2-[3-(2-nitrophenoxy)propyl]-1-(phenoxymethyl)-3,4-dihydro-1H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 53391190 |
| Molecular Formula | C27H31ClN2O6 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 6,7-dimethoxy-2-[3-(2-nitrophenoxy)propyl]-1-(phenoxymethyl)-3,4-dihydro-1H-isoquinoline;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(COc1ccccc1)N(CCCOc1ccccc1[N+](=O)[O-])CC2.Cl |
| InChI | InChI=1S/C27H30N2O6.ClH/c1-32-26-17-20-13-15-28(14-8-16-34-25-12-7-6-11-23(25)29(30)31)24(22(20)18-27(26)33-2)19-35-21-9-4-3-5-10-21;/h3-7,9-12,17-18,24H,8,13-16,19H2,1-2H3;1H |
| InChIKey | DOKZYXDJNCMJBQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|