C24H25N3O5S — CID 134913479
(1R)-6,7-dimethoxy-1-[[(R)-(2-nitrophenyl)sulfinyl]methyl]-2-(pyridin-2-ylmethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 134913479) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is (1R)-6,7-dimethoxy-1-[[(R)-(2-nitrophenyl)sulfinyl]methyl]-2-(pyridin-2-ylmethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1R)-6,7-dimethoxy-1-[[(R)-(2-nitrophenyl)sulfinyl]methyl]-2-(pyridin-2-ylmethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 134913479 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (1R)-6,7-dimethoxy-1-[[(R)-(2-nitrophenyl)sulfinyl]methyl]-2-(pyridin-2-ylmethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@H](C[S@@](=O)c1ccccc1[N+](=O)[O-])N(Cc1ccccn1)CC2 |
| InChI | InChI=1S/C24H25N3O5S/c1-31-22-13-17-10-12-26(15-18-7-5-6-11-25-18)21(19(17)14-23(22)32-2)16-33(30)24-9-4-3-8-20(24)27(28)29/h3-9,11,13-14,21H,10,12,15-16H2,1-2H3/t21-,33+/m0/s1 |
| InChIKey | IVZIRIOWNVFEDD-AUSOSSAASA-N |
| XLogP | 3.91 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|