C19H23ClN2O5 — CID 53390918
6,7-dimethoxy-2-[2-(2-nitrophenoxy)ethyl]-3,4-dihydro-1H-isoquinoline;hydrochloride (PubChem CID 53390918) has the molecular formula C19H23ClN2O5 and a molecular weight of 394.86 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[2-(2-nitrophenoxy)ethyl]-3,4-dihydro-1H-isoquinoline;hydrochloride.
| Compound Name | 6,7-dimethoxy-2-[2-(2-nitrophenoxy)ethyl]-3,4-dihydro-1H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 53390918 |
| Molecular Formula | C19H23ClN2O5 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 6,7-dimethoxy-2-[2-(2-nitrophenoxy)ethyl]-3,4-dihydro-1H-isoquinoline;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CN(CCOc1ccccc1[N+](=O)[O-])CC2.Cl |
| InChI | InChI=1S/C19H22N2O5.ClH/c1-24-18-11-14-7-8-20(13-15(14)12-19(18)25-2)9-10-26-17-6-4-3-5-16(17)21(22)23;/h3-6,11-12H,7-10,13H2,1-2H3;1H |
| InChIKey | LZIXZIFKSZWHIJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|