C27H29N3O5 — CID 20646975
N-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]phenyl]-2-nitrobenzamide (PubChem CID 20646975) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]phenyl]-2-nitrobenzamide.
| Compound Name | N-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 20646975 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]phenyl]-2-nitrobenzamide |
| SMILES | COc1cc2c(cc1OC)CN(CC(C)c1ccc(NC(=O)c3ccccc3[N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C27H29N3O5/c1-18(16-29-13-12-20-14-25(34-2)26(35-3)15-21(20)17-29)19-8-10-22(11-9-19)28-27(31)23-6-4-5-7-24(23)30(32)33/h4-11,14-15,18H,12-13,16-17H2,1-3H3,(H,28,31) |
| InChIKey | TYWHUAJYLCIELM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|