C28H29N3O7 — CID 25223300
methyl 4-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]carbamoyl]-2-nitrobenzoate (PubChem CID 25223300) has the molecular formula C28H29N3O7 and a molecular weight of 519.55 g/mol. Its IUPAC name is methyl 4-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]carbamoyl]-2-nitrobenzoate.
| Compound Name | methyl 4-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]carbamoyl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 25223300 |
| Molecular Formula | C28H29N3O7 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | methyl 4-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]carbamoyl]-2-nitrobenzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(CCN3CCc4cc(OC)c(OC)cc4C3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H29N3O7/c1-36-25-15-19-11-13-30(17-21(19)16-26(25)37-2)12-10-18-4-7-22(8-5-18)29-27(32)20-6-9-23(28(33)38-3)24(14-20)31(34)35/h4-9,14-16H,10-13,17H2,1-3H3,(H,29,32) |
| InChIKey | MCLQGKSRZLUAIZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|