C26H27N3O5 — CID 20646964
N-[3-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-2-nitrobenzamide (PubChem CID 20646964) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[3-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-2-nitrobenzamide.
| Compound Name | N-[3-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 20646964 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-[3-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-2-nitrobenzamide |
| SMILES | COc1cc2c(cc1OC)CN(CCc1cccc(NC(=O)c3ccccc3[N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C26H27N3O5/c1-33-24-15-19-11-13-28(17-20(19)16-25(24)34-2)12-10-18-6-5-7-21(14-18)27-26(30)22-8-3-4-9-23(22)29(31)32/h3-9,14-16H,10-13,17H2,1-2H3,(H,27,30) |
| InChIKey | FHEUVQZMSOMVAZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|