C20H28N2O3 — CID 90843010
ethane;2-nitro-N-(3-propylphenyl)benzamide (PubChem CID 90843010) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is ethane;2-nitro-N-(3-propylphenyl)benzamide.
| Compound Name | ethane;2-nitro-N-(3-propylphenyl)benzamide |
|---|---|
| PubChem CID | 90843010 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | ethane;2-nitro-N-(3-propylphenyl)benzamide |
| SMILES | CC.CC.CCCc1cccc(NC(=O)c2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N2O3.2C2H6/c1-2-6-12-7-5-8-13(11-12)17-16(19)14-9-3-4-10-15(14)18(20)21;2*1-2/h3-5,7-11H,2,6H2,1H3,(H,17,19);2*1-2H3 |
| InChIKey | SFASDIQCLVQNQW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|