C26H29N3O4 — CID 141405014
4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-N-[(2-nitrophenyl)methyl]aniline (PubChem CID 141405014) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-N-[(2-nitrophenyl)methyl]aniline.
| Compound Name | 4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-N-[(2-nitrophenyl)methyl]aniline |
|---|---|
| PubChem CID | 141405014 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-N-[(2-nitrophenyl)methyl]aniline |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(NCc3ccccc3[N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C26H29N3O4/c1-32-25-15-20-12-14-28(18-22(20)16-26(25)33-2)13-11-19-7-9-23(10-8-19)27-17-21-5-3-4-6-24(21)29(30)31/h3-10,15-16,27H,11-14,17-18H2,1-2H3 |
| InChIKey | ZAFAIZGHHRLVJT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|