C26H26N6O5 — CID 163249274
3-[2-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]tetrazol-5-yl]-4-nitrophenol (PubChem CID 163249274) has the molecular formula C26H26N6O5 and a molecular weight of 502.53 g/mol. Its IUPAC name is 3-[2-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]tetrazol-5-yl]-4-nitrophenol.
| Compound Name | 3-[2-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]tetrazol-5-yl]-4-nitrophenol |
|---|---|
| PubChem CID | 163249274 |
| Molecular Formula | C26H26N6O5 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 3-[2-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]tetrazol-5-yl]-4-nitrophenol |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(-n3nnc(-c4cc(O)ccc4[N+](=O)[O-])n3)cc1)CC2 |
| InChI | InChI=1S/C26H26N6O5/c1-36-24-13-18-10-12-30(16-19(18)14-25(24)37-2)11-9-17-3-5-20(6-4-17)31-28-26(27-29-31)22-15-21(33)7-8-23(22)32(34)35/h3-8,13-15,33H,9-12,16H2,1-2H3 |
| InChIKey | LUVYWYHLTJUUCF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|