C25H25N7O3 — CID 164965373
2-[2-[4-[5-(4-methoxy-5-methyl-2-nitrophenyl)tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-2,6-naphthyridine (PubChem CID 164965373) has the molecular formula C25H25N7O3 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-[2-[4-[5-(4-methoxy-5-methyl-2-nitrophenyl)tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-2,6-naphthyridine.
| Compound Name | 2-[2-[4-[5-(4-methoxy-5-methyl-2-nitrophenyl)tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-2,6-naphthyridine |
|---|---|
| PubChem CID | 164965373 |
| Molecular Formula | C25H25N7O3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-[2-[4-[5-(4-methoxy-5-methyl-2-nitrophenyl)tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-2,6-naphthyridine |
| SMILES | COc1cc([N+](=O)[O-])c(-c2nnn(-c3ccc(CCN4CCc5cnccc5C4)cc3)n2)cc1C |
| InChI | InChI=1S/C25H25N7O3/c1-17-13-22(23(32(33)34)14-24(17)35-2)25-27-29-31(28-25)21-5-3-18(4-6-21)8-11-30-12-9-19-15-26-10-7-20(19)16-30/h3-7,10,13-15H,8-9,11-12,16H2,1-2H3 |
| InChIKey | XKVMPYTWNRHBCH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 112.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|