C27H31N3O3 — CID 20646909
2-amino-N-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]phenyl]benzamide (PubChem CID 20646909) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 2-amino-N-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]phenyl]benzamide.
| Compound Name | 2-amino-N-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 20646909 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 2-amino-N-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-yl]phenyl]benzamide |
| SMILES | COc1cc2c(cc1OC)CN(CC(C)c1ccc(NC(=O)c3ccccc3N)cc1)CC2 |
| InChI | InChI=1S/C27H31N3O3/c1-18(16-30-13-12-20-14-25(32-2)26(33-3)15-21(20)17-30)19-8-10-22(11-9-19)29-27(31)23-6-4-5-7-24(23)28/h4-11,14-15,18H,12-13,16-17,28H2,1-3H3,(H,29,31) |
| InChIKey | RJHSDHORMLRRET-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|