C26H23N3O6 — CID 43001031
2-[(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-nitroisoindole-1,3-dione (PubChem CID 43001031) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is 2-[(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 43001031 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 2-[(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-nitroisoindole-1,3-dione |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)N(CN1C(=O)c3cccc([N+](=O)[O-])c3C1=O)CC2 |
| InChI | InChI=1S/C26H23N3O6/c1-34-21-13-17-11-12-27(24(16-7-4-3-5-8-16)19(17)14-22(21)35-2)15-28-25(30)18-9-6-10-20(29(32)33)23(18)26(28)31/h3-10,13-14,24H,11-12,15H2,1-2H3 |
| InChIKey | WYTQFNADQHWVJA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|