C26H26N2O6 — CID 55409734
6,7-dimethoxy-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-1-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 55409734) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-1-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-1-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 55409734 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 6,7-dimethoxy-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-1-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)N(Cc1cc([N+](=O)[O-])cc3c1OCOC3)CC2 |
| InChI | InChI=1S/C26H26N2O6/c1-31-23-12-18-8-9-27(25(17-6-4-3-5-7-17)22(18)13-24(23)32-2)14-19-10-21(28(29)30)11-20-15-33-16-34-26(19)20/h3-7,10-13,25H,8-9,14-16H2,1-2H3 |
| InChIKey | NHPFHHHVYLFGFM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|